C21H25NO3S — CID 30218903
(E)-3-(4-butoxy-3-methoxyphenyl)-1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)prop-2-en-1-one (PubChem CID 30218903) has the molecular formula C21H25NO3S and a molecular weight of 371.50 g/mol. Its IUPAC name is (E)-3-(4-butoxy-3-methoxyphenyl)-1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)prop-2-en-1-one.
| Compound Name | (E)-3-(4-butoxy-3-methoxyphenyl)-1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 30218903 |
| Molecular Formula | C21H25NO3S |
| Molecular Weight | 371.50 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | (E)-3-(4-butoxy-3-methoxyphenyl)-1-(6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)prop-2-en-1-one |
| SMILES | CCCCOc1ccc(/C=C/C(=O)N2CCc3sccc3C2)cc1OC |
| InChI | InChI=1S/C21H25NO3S/c1-3-4-12-25-18-7-5-16(14-19(18)24-2)6-8-21(23)22-11-9-20-17(15-22)10-13-26-20/h5-8,10,13-14H,3-4,9,11-12,15H2,1-2H3/b8-6+ |
| InChIKey | YXUYKJVTLOJUJM-SOFGYWHQSA-N |
| XLogP | 4.53 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|