C22H25NO3S — CID 18278405
(E)-1-(4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-en-1-one (PubChem CID 18278405) has the molecular formula C22H25NO3S and a molecular weight of 383.51 g/mol. Its IUPAC name is (E)-1-(4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 18278405 |
| Molecular Formula | C22H25NO3S |
| Molecular Weight | 383.51 g/mol |
| Exact Mass | 383.16 |
| IUPAC Name | (E)-1-(4-ethyl-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-en-1-one |
| SMILES | C=CCOc1ccc(/C=C/C(=O)N2CCc3sccc3C2CC)cc1OC |
| InChI | InChI=1S/C22H25NO3S/c1-4-13-26-19-8-6-16(15-20(19)25-3)7-9-22(24)23-12-10-21-17(11-14-27-21)18(23)5-2/h4,6-9,11,14-15,18H,1,5,10,12-13H2,2-3H3/b9-7+ |
| InChIKey | FKIJUDIQNMXNES-VQHVLOKHSA-N |
| XLogP | 4.87 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.51 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|