C22H30N2O5 — CID 46532921
tert-butyl 4-[(E)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enoyl]piperazine-1-carboxylate (PubChem CID 46532921) has the molecular formula C22H30N2O5 and a molecular weight of 402.49 g/mol. Its IUPAC name is tert-butyl 4-[(E)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(E)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 46532921 |
| Molecular Formula | C22H30N2O5 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | tert-butyl 4-[(E)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enoyl]piperazine-1-carboxylate |
| SMILES | C=CCOc1ccc(/C=C/C(=O)N2CCN(C(=O)OC(C)(C)C)CC2)cc1OC |
| InChI | InChI=1S/C22H30N2O5/c1-6-15-28-18-9-7-17(16-19(18)27-5)8-10-20(25)23-11-13-24(14-12-23)21(26)29-22(2,3)4/h6-10,16H,1,11-15H2,2-5H3/b10-8+ |
| InChIKey | YNBJFJQFWCYRJB-CSKARUKUSA-N |
| XLogP | 3.35 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|