C25H25F3N2O4 — CID 55746686
(E)-3-(3-methoxy-4-prop-2-enoxyphenyl)-1-[4-[3-(trifluoromethyl)benzoyl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 55746686) has the molecular formula C25H25F3N2O4 and a molecular weight of 474.48 g/mol. Its IUPAC name is (E)-3-(3-methoxy-4-prop-2-enoxyphenyl)-1-[4-[3-(trifluoromethyl)benzoyl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3-methoxy-4-prop-2-enoxyphenyl)-1-[4-[3-(trifluoromethyl)benzoyl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 55746686 |
| Molecular Formula | C25H25F3N2O4 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | (E)-3-(3-methoxy-4-prop-2-enoxyphenyl)-1-[4-[3-(trifluoromethyl)benzoyl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | C=CCOc1ccc(/C=C/C(=O)N2CCN(C(=O)c3cccc(C(F)(F)F)c3)CC2)cc1OC |
| InChI | InChI=1S/C25H25F3N2O4/c1-3-15-34-21-9-7-18(16-22(21)33-2)8-10-23(31)29-11-13-30(14-12-29)24(32)19-5-4-6-20(17-19)25(26,27)28/h3-10,16-17H,1,11-15H2,2H3/b10-8+ |
| InChIKey | IXMRUUWALVHRRK-CSKARUKUSA-N |
| XLogP | 4.28 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|