C24H28N2O4 — CID 108935064
(E)-1-[4-(3,4-dimethoxybenzoyl)-1,4-diazepan-1-yl]-3-(3-methylphenyl)prop-2-en-1-one (PubChem CID 108935064) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is (E)-1-[4-(3,4-dimethoxybenzoyl)-1,4-diazepan-1-yl]-3-(3-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(3,4-dimethoxybenzoyl)-1,4-diazepan-1-yl]-3-(3-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 108935064 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (E)-1-[4-(3,4-dimethoxybenzoyl)-1,4-diazepan-1-yl]-3-(3-methylphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C(=O)N2CCCN(C(=O)/C=C/c3cccc(C)c3)CC2)cc1OC |
| InChI | InChI=1S/C24H28N2O4/c1-18-6-4-7-19(16-18)8-11-23(27)25-12-5-13-26(15-14-25)24(28)20-9-10-21(29-2)22(17-20)30-3/h4,6-11,16-17H,5,12-15H2,1-3H3/b11-8+ |
| InChIKey | NRGUKJWGYRDWRA-DHZHZOJOSA-N |
| XLogP | 3.40 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|