C24H28N2O5 — CID 108935060
(E)-1-[4-(3,4-dimethoxybenzoyl)-1,4-diazepan-1-yl]-3-(2-methoxyphenyl)prop-2-en-1-one (PubChem CID 108935060) has the molecular formula C24H28N2O5 and a molecular weight of 424.50 g/mol. Its IUPAC name is (E)-1-[4-(3,4-dimethoxybenzoyl)-1,4-diazepan-1-yl]-3-(2-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(3,4-dimethoxybenzoyl)-1,4-diazepan-1-yl]-3-(2-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 108935060 |
| Molecular Formula | C24H28N2O5 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.20 |
| IUPAC Name | (E)-1-[4-(3,4-dimethoxybenzoyl)-1,4-diazepan-1-yl]-3-(2-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccccc1/C=C/C(=O)N1CCCN(C(=O)c2ccc(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C24H28N2O5/c1-29-20-8-5-4-7-18(20)10-12-23(27)25-13-6-14-26(16-15-25)24(28)19-9-11-21(30-2)22(17-19)31-3/h4-5,7-12,17H,6,13-16H2,1-3H3/b12-10+ |
| InChIKey | AJLYCNZKEZZVNW-ZRDIBKRKSA-N |
| XLogP | 3.10 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|