C22H23ClN2O3 — CID 55551303
(E)-1-[4-(4-chlorobenzoyl)piperazin-1-yl]-3-(2-methoxy-5-methylphenyl)prop-2-en-1-one (PubChem CID 55551303) has the molecular formula C22H23ClN2O3 and a molecular weight of 398.89 g/mol. Its IUPAC name is (E)-1-[4-(4-chlorobenzoyl)piperazin-1-yl]-3-(2-methoxy-5-methylphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-[4-(4-chlorobenzoyl)piperazin-1-yl]-3-(2-methoxy-5-methylphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 55551303 |
| Molecular Formula | C22H23ClN2O3 |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | (E)-1-[4-(4-chlorobenzoyl)piperazin-1-yl]-3-(2-methoxy-5-methylphenyl)prop-2-en-1-one |
| SMILES | COc1ccc(C)cc1/C=C/C(=O)N1CCN(C(=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C22H23ClN2O3/c1-16-3-9-20(28-2)18(15-16)6-10-21(26)24-11-13-25(14-12-24)22(27)17-4-7-19(23)8-5-17/h3-10,15H,11-14H2,1-2H3/b10-6+ |
| InChIKey | JTIMQVIGBUCNKS-UXBLZVDNSA-N |
| XLogP | 3.65 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|