C25H27N3O4 — CID 108543796
[4-(3,4-dimethoxybenzoyl)-1,4-diazepan-1-yl]-(4-pyrrol-1-ylphenyl)methanone (PubChem CID 108543796) has the molecular formula C25H27N3O4 and a molecular weight of 433.51 g/mol. Its IUPAC name is [4-(3,4-dimethoxybenzoyl)-1,4-diazepan-1-yl]-(4-pyrrol-1-ylphenyl)methanone.
| Compound Name | [4-(3,4-dimethoxybenzoyl)-1,4-diazepan-1-yl]-(4-pyrrol-1-ylphenyl)methanone |
|---|---|
| PubChem CID | 108543796 |
| Molecular Formula | C25H27N3O4 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.20 |
| IUPAC Name | [4-(3,4-dimethoxybenzoyl)-1,4-diazepan-1-yl]-(4-pyrrol-1-ylphenyl)methanone |
| SMILES | COc1ccc(C(=O)N2CCCN(C(=O)c3ccc(-n4cccc4)cc3)CC2)cc1OC |
| InChI | InChI=1S/C25H27N3O4/c1-31-22-11-8-20(18-23(22)32-2)25(30)28-15-5-14-27(16-17-28)24(29)19-6-9-21(10-7-19)26-12-3-4-13-26/h3-4,6-13,18H,5,14-17H2,1-2H3 |
| InChIKey | YDQYCUMWQOFBNR-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 64.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |