C20H23N3O4 — CID 108934968
(4-aminophenyl)-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]methanone (PubChem CID 108934968) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is (4-aminophenyl)-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]methanone.
| Compound Name | (4-aminophenyl)-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 108934968 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | (4-aminophenyl)-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(C(=O)N2CCN(C(=O)c3ccc(N)cc3)CC2)cc1OC |
| InChI | InChI=1S/C20H23N3O4/c1-26-17-8-5-15(13-18(17)27-2)20(25)23-11-9-22(10-12-23)19(24)14-3-6-16(21)7-4-14/h3-8,13H,9-12,21H2,1-2H3 |
| InChIKey | MKYSIANNSLPTLU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|