C20H23N3O5 — CID 139774630
2-amino-5-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]benzoic acid (PubChem CID 139774630) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is 2-amino-5-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]benzoic acid.
| Compound Name | 2-amino-5-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 139774630 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 2-amino-5-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]benzoic acid |
| SMILES | COc1ccc(C(=O)N2CCN(c3ccc(N)c(C(=O)O)c3)CC2)cc1OC |
| InChI | InChI=1S/C20H23N3O5/c1-27-17-6-3-13(11-18(17)28-2)19(24)23-9-7-22(8-10-23)14-4-5-16(21)15(12-14)20(25)26/h3-6,11-12H,7-10,21H2,1-2H3,(H,25,26) |
| InChIKey | IKOCYVCMKHWKPP-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 105.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|