C20H21N3O3 — CID 113081043
4-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]benzonitrile (PubChem CID 113081043) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 4-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]benzonitrile.
| Compound Name | 4-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 113081043 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 4-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]benzonitrile |
| SMILES | COc1ccc(C(=O)N2CCN(c3ccc(C#N)cc3)CC2)cc1OC |
| InChI | InChI=1S/C20H21N3O3/c1-25-18-8-5-16(13-19(18)26-2)20(24)23-11-9-22(10-12-23)17-6-3-15(14-21)4-7-17/h3-8,13H,9-12H2,1-2H3 |
| InChIKey | PDKMVRNKCXLTLC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 65.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |