C19H20N4O3 — CID 31662337
6-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]pyridine-3-carbonitrile (PubChem CID 31662337) has the molecular formula C19H20N4O3 and a molecular weight of 352.39 g/mol. Its IUPAC name is 6-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 31662337 |
| Molecular Formula | C19H20N4O3 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.15 |
| IUPAC Name | 6-[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]pyridine-3-carbonitrile |
| SMILES | COc1ccc(C(=O)N2CCN(c3ccc(C#N)cn3)CC2)cc1OC |
| InChI | InChI=1S/C19H20N4O3/c1-25-16-5-4-15(11-17(16)26-2)19(24)23-9-7-22(8-10-23)18-6-3-14(12-20)13-21-18/h3-6,11,13H,7-10H2,1-2H3 |
| InChIKey | HWFCLGNLXFDWMU-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 78.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |