C25H21N5O2 — CID 69003377
6-[4-[4-methoxy-3-(2-pyridin-2-ylethynyl)benzoyl]piperazin-1-yl]pyridine-3-carbonitrile (PubChem CID 69003377) has the molecular formula C25H21N5O2 and a molecular weight of 423.48 g/mol. Its IUPAC name is 6-[4-[4-methoxy-3-(2-pyridin-2-ylethynyl)benzoyl]piperazin-1-yl]pyridine-3-carbonitrile.
| Compound Name | 6-[4-[4-methoxy-3-(2-pyridin-2-ylethynyl)benzoyl]piperazin-1-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 69003377 |
| Molecular Formula | C25H21N5O2 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 6-[4-[4-methoxy-3-(2-pyridin-2-ylethynyl)benzoyl]piperazin-1-yl]pyridine-3-carbonitrile |
| SMILES | COc1ccc(C(=O)N2CCN(c3ccc(C#N)cn3)CC2)cc1C#Cc1ccccn1 |
| InChI | InChI=1S/C25H21N5O2/c1-32-23-9-7-21(16-20(23)6-8-22-4-2-3-11-27-22)25(31)30-14-12-29(13-15-30)24-10-5-19(17-26)18-28-24/h2-5,7,9-11,16,18H,12-15H2,1H3 |
| InChIKey | CTQTYNTWKGOFDP-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 82.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|