C27H22ClN5O2 — CID 87649884
[4-(4-chlorophthalazin-1-yl)piperazin-1-yl]-[4-methoxy-3-(2-pyridin-2-ylethynyl)phenyl]methanone (PubChem CID 87649884) has the molecular formula C27H22ClN5O2 and a molecular weight of 483.96 g/mol. Its IUPAC name is [4-(4-chlorophthalazin-1-yl)piperazin-1-yl]-[4-methoxy-3-(2-pyridin-2-ylethynyl)phenyl]methanone.
| Compound Name | [4-(4-chlorophthalazin-1-yl)piperazin-1-yl]-[4-methoxy-3-(2-pyridin-2-ylethynyl)phenyl]methanone |
|---|---|
| PubChem CID | 87649884 |
| Molecular Formula | C27H22ClN5O2 |
| Molecular Weight | 483.96 g/mol |
| Exact Mass | 483.15 |
| IUPAC Name | [4-(4-chlorophthalazin-1-yl)piperazin-1-yl]-[4-methoxy-3-(2-pyridin-2-ylethynyl)phenyl]methanone |
| SMILES | COc1ccc(C(=O)N2CCN(c3nnc(Cl)c4ccccc34)CC2)cc1C#Cc1ccccn1 |
| InChI | InChI=1S/C27H22ClN5O2/c1-35-24-12-10-20(18-19(24)9-11-21-6-4-5-13-29-21)27(34)33-16-14-32(15-17-33)26-23-8-3-2-7-22(23)25(28)30-31-26/h2-8,10,12-13,18H,14-17H2,1H3 |
| InChIKey | HRGDBBJFHCSWDI-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.96 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|