C24H22N4O2 — CID 69038567
[4-(3-methoxy-2-pyridinyl)piperazin-1-yl]-[3-(2-pyridin-2-ylethynyl)phenyl]methanone (PubChem CID 69038567) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is [4-(3-methoxy-2-pyridinyl)piperazin-1-yl]-[3-(2-pyridin-2-ylethynyl)phenyl]methanone.
| Compound Name | [4-(3-methoxy-2-pyridinyl)piperazin-1-yl]-[3-(2-pyridin-2-ylethynyl)phenyl]methanone |
|---|---|
| PubChem CID | 69038567 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | [4-(3-methoxy-2-pyridinyl)piperazin-1-yl]-[3-(2-pyridin-2-ylethynyl)phenyl]methanone |
| SMILES | COc1cccnc1N1CCN(C(=O)c2cccc(C#Cc3ccccn3)c2)CC1 |
| InChI | InChI=1S/C24H22N4O2/c1-30-22-9-5-13-26-23(22)27-14-16-28(17-15-27)24(29)20-7-4-6-19(18-20)10-11-21-8-2-3-12-25-21/h2-9,12-13,18H,14-17H2,1H3 |
| InChIKey | ZJCCQYXQJQFBPE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|