C25H22F2N4O3 — CID 44513570
[3-[2-[3-(difluoromethoxy)phenyl]ethynyl]-4-methoxyphenyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone (PubChem CID 44513570) has the molecular formula C25H22F2N4O3 and a molecular weight of 464.47 g/mol. Its IUPAC name is [3-[2-[3-(difluoromethoxy)phenyl]ethynyl]-4-methoxyphenyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [3-[2-[3-(difluoromethoxy)phenyl]ethynyl]-4-methoxyphenyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 44513570 |
| Molecular Formula | C25H22F2N4O3 |
| Molecular Weight | 464.47 g/mol |
| Exact Mass | 464.17 |
| IUPAC Name | [3-[2-[3-(difluoromethoxy)phenyl]ethynyl]-4-methoxyphenyl]-(4-pyrimidin-2-ylpiperazin-1-yl)methanone |
| SMILES | COc1ccc(C(=O)N2CCN(c3ncccn3)CC2)cc1C#Cc1cccc(OC(F)F)c1 |
| InChI | InChI=1S/C25H22F2N4O3/c1-33-22-9-8-20(17-19(22)7-6-18-4-2-5-21(16-18)34-24(26)27)23(32)30-12-14-31(15-13-30)25-28-10-3-11-29-25/h2-5,8-11,16-17,24H,12-15H2,1H3 |
| InChIKey | PWVHKJGIFXYOIR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 67.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|