C26H22N4O2S — CID 44515711
[4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-[4-methoxy-3-(2-pyridin-2-ylethynyl)phenyl]methanone (PubChem CID 44515711) has the molecular formula C26H22N4O2S and a molecular weight of 454.56 g/mol. Its IUPAC name is [4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-[4-methoxy-3-(2-pyridin-2-ylethynyl)phenyl]methanone.
| Compound Name | [4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-[4-methoxy-3-(2-pyridin-2-ylethynyl)phenyl]methanone |
|---|---|
| PubChem CID | 44515711 |
| Molecular Formula | C26H22N4O2S |
| Molecular Weight | 454.56 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | [4-(1,2-benzothiazol-3-yl)piperazin-1-yl]-[4-methoxy-3-(2-pyridin-2-ylethynyl)phenyl]methanone |
| SMILES | COc1ccc(C(=O)N2CCN(c3nsc4ccccc34)CC2)cc1C#Cc1ccccn1 |
| InChI | InChI=1S/C26H22N4O2S/c1-32-23-12-10-20(18-19(23)9-11-21-6-4-5-13-27-21)26(31)30-16-14-29(15-17-30)25-22-7-2-3-8-24(22)33-28-25/h2-8,10,12-13,18H,14-17H2,1H3 |
| InChIKey | GLAVFMFDMAVPIX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.56 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|