C26H22N4O2 — CID 58024923
[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-[4-methyl-3-(2-pyridin-2-ylethynyl)phenyl]methanone (PubChem CID 58024923) has the molecular formula C26H22N4O2 and a molecular weight of 422.49 g/mol. Its IUPAC name is [4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-[4-methyl-3-(2-pyridin-2-ylethynyl)phenyl]methanone.
| Compound Name | [4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-[4-methyl-3-(2-pyridin-2-ylethynyl)phenyl]methanone |
|---|---|
| PubChem CID | 58024923 |
| Molecular Formula | C26H22N4O2 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | [4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-[4-methyl-3-(2-pyridin-2-ylethynyl)phenyl]methanone |
| SMILES | Cc1ccc(C(=O)N2CCN(c3noc4ccccc34)CC2)cc1C#Cc1ccccn1 |
| InChI | InChI=1S/C26H22N4O2/c1-19-9-10-21(18-20(19)11-12-22-6-4-5-13-27-22)26(31)30-16-14-29(15-17-30)25-23-7-2-3-8-24(23)32-28-25/h2-10,13,18H,14-17H2,1H3 |
| InChIKey | LCIOJLSTBMDJJX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 62.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|