C26H19F3N4O3 — CID 44512579
[4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-[3-(2-pyridin-2-ylethynyl)-4-(trifluoromethoxy)phenyl]methanone (PubChem CID 44512579) has the molecular formula C26H19F3N4O3 and a molecular weight of 492.46 g/mol. Its IUPAC name is [4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-[3-(2-pyridin-2-ylethynyl)-4-(trifluoromethoxy)phenyl]methanone.
| Compound Name | [4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-[3-(2-pyridin-2-ylethynyl)-4-(trifluoromethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 44512579 |
| Molecular Formula | C26H19F3N4O3 |
| Molecular Weight | 492.46 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | [4-(1,2-benzoxazol-3-yl)piperazin-1-yl]-[3-(2-pyridin-2-ylethynyl)-4-(trifluoromethoxy)phenyl]methanone |
| SMILES | O=C(c1ccc(OC(F)(F)F)c(C#Cc2ccccn2)c1)N1CCN(c2noc3ccccc23)CC1 |
| InChI | InChI=1S/C26H19F3N4O3/c27-26(28,29)35-22-11-9-19(17-18(22)8-10-20-5-3-4-12-30-20)25(34)33-15-13-32(14-16-33)24-21-6-1-2-7-23(21)36-31-24/h1-7,9,11-12,17H,13-16H2 |
| InChIKey | NFFXENMNVNASBG-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 71.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|