C25H24N4O2 — CID 53323847
[4-methoxy-3-[2-(6-methyl-2-pyridinyl)ethynyl]phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone (PubChem CID 53323847) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is [4-methoxy-3-[2-(6-methyl-2-pyridinyl)ethynyl]phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone.
| Compound Name | [4-methoxy-3-[2-(6-methyl-2-pyridinyl)ethynyl]phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 53323847 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | [4-methoxy-3-[2-(6-methyl-2-pyridinyl)ethynyl]phenyl]-(4-pyridin-2-ylpiperazin-1-yl)methanone |
| SMILES | COc1ccc(C(=O)N2CCN(c3ccccn3)CC2)cc1C#Cc1cccc(C)n1 |
| InChI | InChI=1S/C25H24N4O2/c1-19-6-5-7-22(27-19)11-9-20-18-21(10-12-23(20)31-2)25(30)29-16-14-28(15-17-29)24-8-3-4-13-26-24/h3-8,10,12-13,18H,14-17H2,1-2H3 |
| InChIKey | CFASCWUCSYDJAJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|