C23H17FN2O2 — CID 46945593
(4-fluoro-1,3-dihydroisoindol-2-yl)-[4-methoxy-3-(2-pyridin-2-ylethynyl)phenyl]methanone (PubChem CID 46945593) has the molecular formula C23H17FN2O2 and a molecular weight of 372.40 g/mol. Its IUPAC name is (4-fluoro-1,3-dihydroisoindol-2-yl)-[4-methoxy-3-(2-pyridin-2-ylethynyl)phenyl]methanone.
| Compound Name | (4-fluoro-1,3-dihydroisoindol-2-yl)-[4-methoxy-3-(2-pyridin-2-ylethynyl)phenyl]methanone |
|---|---|
| PubChem CID | 46945593 |
| Molecular Formula | C23H17FN2O2 |
| Molecular Weight | 372.40 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | (4-fluoro-1,3-dihydroisoindol-2-yl)-[4-methoxy-3-(2-pyridin-2-ylethynyl)phenyl]methanone |
| SMILES | COc1ccc(C(=O)N2Cc3cccc(F)c3C2)cc1C#Cc1ccccn1 |
| InChI | InChI=1S/C23H17FN2O2/c1-28-22-11-9-17(13-16(22)8-10-19-6-2-3-12-25-19)23(27)26-14-18-5-4-7-21(24)20(18)15-26/h2-7,9,11-13H,14-15H2,1H3 |
| InChIKey | HAFAHXHSZNZDNF-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.40 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|