C23H16ClFN2O — CID 46946591
(5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-[4-fluoro-3-(2-pyridin-2-ylethynyl)phenyl]methanone (PubChem CID 46946591) has the molecular formula C23H16ClFN2O and a molecular weight of 390.85 g/mol. Its IUPAC name is (5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-[4-fluoro-3-(2-pyridin-2-ylethynyl)phenyl]methanone.
| Compound Name | (5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-[4-fluoro-3-(2-pyridin-2-ylethynyl)phenyl]methanone |
|---|---|
| PubChem CID | 46946591 |
| Molecular Formula | C23H16ClFN2O |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | (5-chloro-3,4-dihydro-1H-isoquinolin-2-yl)-[4-fluoro-3-(2-pyridin-2-ylethynyl)phenyl]methanone |
| SMILES | O=C(c1ccc(F)c(C#Cc2ccccn2)c1)N1CCc2c(Cl)cccc2C1 |
| InChI | InChI=1S/C23H16ClFN2O/c24-21-6-3-4-18-15-27(13-11-20(18)21)23(28)17-8-10-22(25)16(14-17)7-9-19-5-1-2-12-26-19/h1-6,8,10,12,14H,11,13,15H2 |
| InChIKey | BWZHWBNVILACPD-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|