C15H14FN3O — CID 63188563
(4-amino-3-fluorophenyl)-(7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone (PubChem CID 63188563) has the molecular formula C15H14FN3O and a molecular weight of 271.30 g/mol. Its IUPAC name is (4-amino-3-fluorophenyl)-(7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone.
| Compound Name | (4-amino-3-fluorophenyl)-(7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone |
|---|---|
| PubChem CID | 63188563 |
| Molecular Formula | C15H14FN3O |
| Molecular Weight | 271.30 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | (4-amino-3-fluorophenyl)-(7,8-dihydro-5H-1,6-naphthyridin-6-yl)methanone |
| SMILES | Nc1ccc(C(=O)N2CCc3ncccc3C2)cc1F |
| InChI | InChI=1S/C15H14FN3O/c16-12-8-10(3-4-13(12)17)15(20)19-7-5-14-11(9-19)2-1-6-18-14/h1-4,6,8H,5,7,9,17H2 |
| InChIKey | XOQUMPFGCPUZOA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|