C14H12FN3O — CID 113323469
7,8-dihydro-5H-1,6-naphthyridin-6-yl-(6-fluoro-2-pyridinyl)methanone (PubChem CID 113323469) has the molecular formula C14H12FN3O and a molecular weight of 257.27 g/mol. Its IUPAC name is 7,8-dihydro-5H-1,6-naphthyridin-6-yl-(6-fluoro-2-pyridinyl)methanone.
| Compound Name | 7,8-dihydro-5H-1,6-naphthyridin-6-yl-(6-fluoro-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 113323469 |
| Molecular Formula | C14H12FN3O |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 7,8-dihydro-5H-1,6-naphthyridin-6-yl-(6-fluoro-2-pyridinyl)methanone |
| SMILES | O=C(c1cccc(F)n1)N1CCc2ncccc2C1 |
| InChI | InChI=1S/C14H12FN3O/c15-13-5-1-4-12(17-13)14(19)18-8-6-11-10(9-18)3-2-7-16-11/h1-5,7H,6,8-9H2 |
| InChIKey | WEXNQDYXSQSFGW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|