C16H15FN2O — CID 115497823
(6-fluoro-2-pyridinyl)-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)methanone (PubChem CID 115497823) has the molecular formula C16H15FN2O and a molecular weight of 270.31 g/mol. Its IUPAC name is (6-fluoro-2-pyridinyl)-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)methanone.
| Compound Name | (6-fluoro-2-pyridinyl)-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)methanone |
|---|---|
| PubChem CID | 115497823 |
| Molecular Formula | C16H15FN2O |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (6-fluoro-2-pyridinyl)-(1,3,4,5-tetrahydro-2-benzazepin-2-yl)methanone |
| SMILES | O=C(c1cccc(F)n1)N1CCCc2ccccc2C1 |
| InChI | InChI=1S/C16H15FN2O/c17-15-9-3-8-14(18-15)16(20)19-10-4-7-12-5-1-2-6-13(12)11-19/h1-3,5-6,8-9H,4,7,10-11H2 |
| InChIKey | RDWHHVBHPCDSSL-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|