C11H13FN2O3S — CID 113342783
(1,1-dioxo-1,4-thiazepan-4-yl)-(6-fluoro-2-pyridinyl)methanone (PubChem CID 113342783) has the molecular formula C11H13FN2O3S and a molecular weight of 272.30 g/mol. Its IUPAC name is (1,1-dioxo-1,4-thiazepan-4-yl)-(6-fluoro-2-pyridinyl)methanone.
| Compound Name | (1,1-dioxo-1,4-thiazepan-4-yl)-(6-fluoro-2-pyridinyl)methanone |
|---|---|
| PubChem CID | 113342783 |
| Molecular Formula | C11H13FN2O3S |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | (1,1-dioxo-1,4-thiazepan-4-yl)-(6-fluoro-2-pyridinyl)methanone |
| SMILES | O=C(c1cccc(F)n1)N1CCCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H13FN2O3S/c12-10-4-1-3-9(13-10)11(15)14-5-2-7-18(16,17)8-6-14/h1,3-4H,2,5-8H2 |
| InChIKey | HJEVDWHNCMFDKB-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|