C12H13F2NO3S — CID 113234293
(2,3-difluorophenyl)-(1,1-dioxo-1,4-thiazepan-4-yl)methanone (PubChem CID 113234293) has the molecular formula C12H13F2NO3S and a molecular weight of 289.30 g/mol. Its IUPAC name is (2,3-difluorophenyl)-(1,1-dioxo-1,4-thiazepan-4-yl)methanone.
| Compound Name | (2,3-difluorophenyl)-(1,1-dioxo-1,4-thiazepan-4-yl)methanone |
|---|---|
| PubChem CID | 113234293 |
| Molecular Formula | C12H13F2NO3S |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | (2,3-difluorophenyl)-(1,1-dioxo-1,4-thiazepan-4-yl)methanone |
| SMILES | O=C(c1cccc(F)c1F)N1CCCS(=O)(=O)CC1 |
| InChI | InChI=1S/C12H13F2NO3S/c13-10-4-1-3-9(11(10)14)12(16)15-5-2-7-19(17,18)8-6-15/h1,3-4H,2,5-8H2 |
| InChIKey | BHISZBYOJBASNY-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |