C15H16F2N2O2 — CID 62648905
cyclopropyl-[4-(2,3-difluorobenzoyl)piperazin-1-yl]methanone (PubChem CID 62648905) has the molecular formula C15H16F2N2O2 and a molecular weight of 294.30 g/mol. Its IUPAC name is cyclopropyl-[4-(2,3-difluorobenzoyl)piperazin-1-yl]methanone.
| Compound Name | cyclopropyl-[4-(2,3-difluorobenzoyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 62648905 |
| Molecular Formula | C15H16F2N2O2 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | cyclopropyl-[4-(2,3-difluorobenzoyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cccc(F)c1F)N1CCN(C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C15H16F2N2O2/c16-12-3-1-2-11(13(12)17)15(21)19-8-6-18(7-9-19)14(20)10-4-5-10/h1-3,10H,4-9H2 |
| InChIKey | CMBSQPJXHGIOTC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |