C17H21F2N3O2 — CID 119307957
[4-(2,6-difluorobenzoyl)piperazin-1-yl]-piperidin-4-ylmethanone (PubChem CID 119307957) has the molecular formula C17H21F2N3O2 and a molecular weight of 337.37 g/mol. Its IUPAC name is [4-(2,6-difluorobenzoyl)piperazin-1-yl]-piperidin-4-ylmethanone.
| Compound Name | [4-(2,6-difluorobenzoyl)piperazin-1-yl]-piperidin-4-ylmethanone |
|---|---|
| PubChem CID | 119307957 |
| Molecular Formula | C17H21F2N3O2 |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | [4-(2,6-difluorobenzoyl)piperazin-1-yl]-piperidin-4-ylmethanone |
| SMILES | O=C(c1c(F)cccc1F)N1CCN(C(=O)C2CCNCC2)CC1 |
| InChI | InChI=1S/C17H21F2N3O2/c18-13-2-1-3-14(19)15(13)17(24)22-10-8-21(9-11-22)16(23)12-4-6-20-7-5-12/h1-3,12,20H,4-11H2 |
| InChIKey | PENJYBVBKGFKSB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |