C20H27F2N3O2 — CID 119756701
1-[4-(2,6-difluorobenzoyl)piperazin-1-yl]-3-piperidin-4-ylbutan-1-one (PubChem CID 119756701) has the molecular formula C20H27F2N3O2 and a molecular weight of 379.45 g/mol. Its IUPAC name is 1-[4-(2,6-difluorobenzoyl)piperazin-1-yl]-3-piperidin-4-ylbutan-1-one.
| Compound Name | 1-[4-(2,6-difluorobenzoyl)piperazin-1-yl]-3-piperidin-4-ylbutan-1-one |
|---|---|
| PubChem CID | 119756701 |
| Molecular Formula | C20H27F2N3O2 |
| Molecular Weight | 379.45 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | 1-[4-(2,6-difluorobenzoyl)piperazin-1-yl]-3-piperidin-4-ylbutan-1-one |
| SMILES | CC(CC(=O)N1CCN(C(=O)c2c(F)cccc2F)CC1)C1CCNCC1 |
| InChI | InChI=1S/C20H27F2N3O2/c1-14(15-5-7-23-8-6-15)13-18(26)24-9-11-25(12-10-24)20(27)19-16(21)3-2-4-17(19)22/h2-4,14-15,23H,5-13H2,1H3 |
| InChIKey | BDMZIMFSNMFVQD-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |