C19H28ClN3O — CID 119843578
1-[4-(4-chlorophenyl)piperazin-1-yl]-3-piperidin-4-ylbutan-1-one (PubChem CID 119843578) has the molecular formula C19H28ClN3O and a molecular weight of 349.91 g/mol. Its IUPAC name is 1-[4-(4-chlorophenyl)piperazin-1-yl]-3-piperidin-4-ylbutan-1-one.
| Compound Name | 1-[4-(4-chlorophenyl)piperazin-1-yl]-3-piperidin-4-ylbutan-1-one |
|---|---|
| PubChem CID | 119843578 |
| Molecular Formula | C19H28ClN3O |
| Molecular Weight | 349.91 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | 1-[4-(4-chlorophenyl)piperazin-1-yl]-3-piperidin-4-ylbutan-1-one |
| SMILES | CC(CC(=O)N1CCN(c2ccc(Cl)cc2)CC1)C1CCNCC1 |
| InChI | InChI=1S/C19H28ClN3O/c1-15(16-6-8-21-9-7-16)14-19(24)23-12-10-22(11-13-23)18-4-2-17(20)3-5-18/h2-5,15-16,21H,6-14H2,1H3 |
| InChIKey | JUCAMXUFZSNDCJ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.91 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |