C20H30ClN3O — CID 119832674
1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-3-piperidin-4-ylbutan-1-one (PubChem CID 119832674) has the molecular formula C20H30ClN3O and a molecular weight of 363.93 g/mol. Its IUPAC name is 1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-3-piperidin-4-ylbutan-1-one.
| Compound Name | 1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-3-piperidin-4-ylbutan-1-one |
|---|---|
| PubChem CID | 119832674 |
| Molecular Formula | C20H30ClN3O |
| Molecular Weight | 363.93 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | 1-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]-3-piperidin-4-ylbutan-1-one |
| SMILES | CC(CC(=O)N1CCN(Cc2cccc(Cl)c2)CC1)C1CCNCC1 |
| InChI | InChI=1S/C20H30ClN3O/c1-16(18-5-7-22-8-6-18)13-20(25)24-11-9-23(10-12-24)15-17-3-2-4-19(21)14-17/h2-4,14,16,18,22H,5-13,15H2,1H3 |
| InChIKey | IYJZBEOEBAIENZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.93 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |