C18H27Cl2N3O — CID 119932156
2-(3-chlorophenyl)-1-[4-(piperidin-4-ylmethyl)piperazin-1-yl]ethanone;hydrochloride (PubChem CID 119932156) has the molecular formula C18H27Cl2N3O and a molecular weight of 372.34 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-[4-(piperidin-4-ylmethyl)piperazin-1-yl]ethanone;hydrochloride.
| Compound Name | 2-(3-chlorophenyl)-1-[4-(piperidin-4-ylmethyl)piperazin-1-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 119932156 |
| Molecular Formula | C18H27Cl2N3O |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-(3-chlorophenyl)-1-[4-(piperidin-4-ylmethyl)piperazin-1-yl]ethanone;hydrochloride |
| SMILES | Cl.O=C(Cc1cccc(Cl)c1)N1CCN(CC2CCNCC2)CC1 |
| InChI | InChI=1S/C18H26ClN3O.ClH/c19-17-3-1-2-16(12-17)13-18(23)22-10-8-21(9-11-22)14-15-4-6-20-7-5-15;/h1-3,12,15,20H,4-11,13-14H2;1H |
| InChIKey | ZPAKSCCZJIYCEJ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |