C18H27Cl2N3O — CID 119930221
2-(4-chlorophenyl)-1-[4-(piperidin-4-ylmethyl)piperazin-1-yl]ethanone;hydrochloride (PubChem CID 119930221) has the molecular formula C18H27Cl2N3O and a molecular weight of 372.34 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-[4-(piperidin-4-ylmethyl)piperazin-1-yl]ethanone;hydrochloride.
| Compound Name | 2-(4-chlorophenyl)-1-[4-(piperidin-4-ylmethyl)piperazin-1-yl]ethanone;hydrochloride |
|---|---|
| PubChem CID | 119930221 |
| Molecular Formula | C18H27Cl2N3O |
| Molecular Weight | 372.34 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 2-(4-chlorophenyl)-1-[4-(piperidin-4-ylmethyl)piperazin-1-yl]ethanone;hydrochloride |
| SMILES | Cl.O=C(Cc1ccc(Cl)cc1)N1CCN(CC2CCNCC2)CC1 |
| InChI | InChI=1S/C18H26ClN3O.ClH/c19-17-3-1-15(2-4-17)13-18(23)22-11-9-21(10-12-22)14-16-5-7-20-8-6-16;/h1-4,16,20H,5-14H2;1H |
| InChIKey | JXZATSGQWBINED-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.34 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |