About (2,6-difluorophenyl)-[4-(piperidin-4-ylmethyl)piperazin-1-yl]methanone;hydrochloride
(2,6-difluorophenyl)-[4-(piperidin-4-ylmethyl)piperazin-1-yl]methanone;hydrochloride (PubChem CID 119931000) has the molecular formula C17H24ClF2N3O
and a molecular weight of 359.85 g/mol. Its IUPAC name is (2,6-difluorophenyl)-[4-(piperidin-4-ylmethyl)piperazin-1-yl]methanone;hydrochloride.
Molecular Properties
| Compound Name | (2,6-difluorophenyl)-[4-(piperidin-4-ylmethyl)piperazin-1-yl]methanone;hydrochloride |
| PubChem CID | 119931000 |
| Molecular Formula | C17H24ClF2N3O |
| Molecular Weight | 359.85 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | (2,6-difluorophenyl)-[4-(piperidin-4-ylmethyl)piperazin-1-yl]methanone;hydrochloride |
| SMILES | Cl.O=C(c1c(F)cccc1F)N1CCN(CC2CCNCC2)CC1 |
| InChI | InChI=1S/C17H23F2N3O.ClH/c18-14-2-1-3-15(19)16(14)17(23)22-10-8-21(9-11-22)12-13-4-6-20-7-5-13;/h1-3,13,20H,4-12H2;1H |
| InChIKey | PNTPUOIYOJSQIV-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.85 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2,6-difluorophenyl)-[4-(piperidin-4-ylmethyl)piperazin-1-yl]methanone;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-difluorophenyl)-[4-(piperidin-4-ylmethyl)piperazin-1-yl]methanone;hydrochloride?
The IUPAC name of (2,6-difluorophenyl)-[4-(piperidin-4-ylmethyl)piperazin-1-yl]methanone;hydrochloride (CID 119931000) is (2,6-difluorophenyl)-[4-(piperidin-4-ylmethyl)piperazin-1-yl]methanone;hydrochloride.
What is the SMILES notation for (2,6-difluorophenyl)-[4-(piperidin-4-ylmethyl)piperazin-1-yl]methanone;hydrochloride?
The canonical SMILES for (2,6-difluorophenyl)-[4-(piperidin-4-ylmethyl)piperazin-1-yl]methanone;hydrochloride is Cl.O=C(c1c(F)cccc1F)N1CCN(CC2CCNCC2)CC1.
What is the InChIKey of (2,6-difluorophenyl)-[4-(piperidin-4-ylmethyl)piperazin-1-yl]methanone;hydrochloride?
The InChIKey is PNTPUOIYOJSQIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23F2N3O.ClH/c18-14-2-1-3-15(19)16(14)17(23)22-10-8-21(9-11-22)12-13-4-6-20-7-5-13;/h1-3,13,20H,4-12H2;1H.
What are the key properties of (2,6-difluorophenyl)-[4-(piperidin-4-ylmethyl)piperazin-1-yl]methanone;hydrochloride?
(2,6-difluorophenyl)-[4-(piperidin-4-ylmethyl)piperazin-1-yl]methanone;hydrochloride has a molecular weight of 359.85 g/mol, XLogP of 2.14, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-difluorophenyl)-[4-(piperidin-4-ylmethyl)piperazin-1-yl]methanone;hydrochloride is sourced from PubChem (CID 119931000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).