C14H17ClN2O2 — CID 95211420
1-[2-(3-chlorophenyl)acetyl]piperidine-4-carboxamide (PubChem CID 95211420) has the molecular formula C14H17ClN2O2 and a molecular weight of 280.75 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)acetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(3-chlorophenyl)acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 95211420 |
| Molecular Formula | C14H17ClN2O2 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1-[2-(3-chlorophenyl)acetyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C14H17ClN2O2/c15-12-3-1-2-10(8-12)9-13(18)17-6-4-11(5-7-17)14(16)19/h1-3,8,11H,4-7,9H2,(H2,16,19) |
| InChIKey | SEPWJVXHEAXFPP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |