C14H18ClN3O2 — CID 108898738
1-N-[(3-chlorophenyl)methyl]piperidine-1,4-dicarboxamide (PubChem CID 108898738) has the molecular formula C14H18ClN3O2 and a molecular weight of 295.77 g/mol. Its IUPAC name is 1-N-[(3-chlorophenyl)methyl]piperidine-1,4-dicarboxamide.
| Compound Name | 1-N-[(3-chlorophenyl)methyl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 108898738 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 1-N-[(3-chlorophenyl)methyl]piperidine-1,4-dicarboxamide |
| SMILES | NC(=O)C1CCN(C(=O)NCc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C14H18ClN3O2/c15-12-3-1-2-10(8-12)9-17-14(20)18-6-4-11(5-7-18)13(16)19/h1-3,8,11H,4-7,9H2,(H2,16,19)(H,17,20) |
| InChIKey | MAHYEUWMFVRNFZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |