C17H19Cl2N3OS — CID 25468861
N-[(3-chlorophenyl)methyl]-4-[(5-chlorothiophen-2-yl)methyl]piperazine-1-carboxamide (PubChem CID 25468861) has the molecular formula C17H19Cl2N3OS and a molecular weight of 384.33 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-4-[(5-chlorothiophen-2-yl)methyl]piperazine-1-carboxamide.
| Compound Name | N-[(3-chlorophenyl)methyl]-4-[(5-chlorothiophen-2-yl)methyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 25468861 |
| Molecular Formula | C17H19Cl2N3OS |
| Molecular Weight | 384.33 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-4-[(5-chlorothiophen-2-yl)methyl]piperazine-1-carboxamide |
| SMILES | O=C(NCc1cccc(Cl)c1)N1CCN(Cc2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C17H19Cl2N3OS/c18-14-3-1-2-13(10-14)11-20-17(23)22-8-6-21(7-9-22)12-15-4-5-16(19)24-15/h1-5,10H,6-9,11-12H2,(H,20,23) |
| InChIKey | RFYKRAOQFNCDEL-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.33 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |