C13H20ClN3O2S — CID 86912545
4-[(5-chlorothiophen-2-yl)methyl]-N-(2-methoxyethyl)piperazine-1-carboxamide (PubChem CID 86912545) has the molecular formula C13H20ClN3O2S and a molecular weight of 317.84 g/mol. Its IUPAC name is 4-[(5-chlorothiophen-2-yl)methyl]-N-(2-methoxyethyl)piperazine-1-carboxamide.
| Compound Name | 4-[(5-chlorothiophen-2-yl)methyl]-N-(2-methoxyethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 86912545 |
| Molecular Formula | C13H20ClN3O2S |
| Molecular Weight | 317.84 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 4-[(5-chlorothiophen-2-yl)methyl]-N-(2-methoxyethyl)piperazine-1-carboxamide |
| SMILES | COCCNC(=O)N1CCN(Cc2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C13H20ClN3O2S/c1-19-9-4-15-13(18)17-7-5-16(6-8-17)10-11-2-3-12(14)20-11/h2-3H,4-10H2,1H3,(H,15,18) |
| InChIKey | PMFVHUOSNVSZHI-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.84 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|