C17H26ClN3OS — CID 42928325
4-[(5-chlorothiophen-2-yl)methyl]-N-(2-methylcyclohexyl)piperazine-1-carboxamide (PubChem CID 42928325) has the molecular formula C17H26ClN3OS and a molecular weight of 355.94 g/mol. Its IUPAC name is 4-[(5-chlorothiophen-2-yl)methyl]-N-(2-methylcyclohexyl)piperazine-1-carboxamide.
| Compound Name | 4-[(5-chlorothiophen-2-yl)methyl]-N-(2-methylcyclohexyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 42928325 |
| Molecular Formula | C17H26ClN3OS |
| Molecular Weight | 355.94 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 4-[(5-chlorothiophen-2-yl)methyl]-N-(2-methylcyclohexyl)piperazine-1-carboxamide |
| SMILES | CC1CCCCC1NC(=O)N1CCN(Cc2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C17H26ClN3OS/c1-13-4-2-3-5-15(13)19-17(22)21-10-8-20(9-11-21)12-14-6-7-16(18)23-14/h6-7,13,15H,2-5,8-12H2,1H3,(H,19,22) |
| InChIKey | KXXVKJZRYQDEES-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.94 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |