C15H22ClN3OS — CID 46700299
2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-N-cyclopropylpropanamide (PubChem CID 46700299) has the molecular formula C15H22ClN3OS and a molecular weight of 327.88 g/mol. Its IUPAC name is 2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-N-cyclopropylpropanamide.
| Compound Name | 2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-N-cyclopropylpropanamide |
|---|---|
| PubChem CID | 46700299 |
| Molecular Formula | C15H22ClN3OS |
| Molecular Weight | 327.88 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | 2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-N-cyclopropylpropanamide |
| SMILES | CC(C(=O)NC1CC1)N1CCN(Cc2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C15H22ClN3OS/c1-11(15(20)17-12-2-3-12)19-8-6-18(7-9-19)10-13-4-5-14(16)21-13/h4-5,11-12H,2-3,6-10H2,1H3,(H,17,20) |
| InChIKey | ZEKAMMKJQPKAEW-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.88 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |