C18H29ClN4OS — CID 30963137
2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-N-(1-ethylpiperidin-4-yl)acetamide (PubChem CID 30963137) has the molecular formula C18H29ClN4OS and a molecular weight of 384.98 g/mol. Its IUPAC name is 2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-N-(1-ethylpiperidin-4-yl)acetamide.
| Compound Name | 2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-N-(1-ethylpiperidin-4-yl)acetamide |
|---|---|
| PubChem CID | 30963137 |
| Molecular Formula | C18H29ClN4OS |
| Molecular Weight | 384.98 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]-N-(1-ethylpiperidin-4-yl)acetamide |
| SMILES | CCN1CCC(NC(=O)CN2CCN(Cc3ccc(Cl)s3)CC2)CC1 |
| InChI | InChI=1S/C18H29ClN4OS/c1-2-21-7-5-15(6-8-21)20-18(24)14-23-11-9-22(10-12-23)13-16-3-4-17(19)25-16/h3-4,15H,2,5-14H2,1H3,(H,20,24) |
| InChIKey | NAXBQVXWYKWMTF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 38.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.98 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |