C18H21Cl2N3OS — CID 30725312
(2R)-N-(2-chlorophenyl)-2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]propanamide (PubChem CID 30725312) has the molecular formula C18H21Cl2N3OS and a molecular weight of 398.36 g/mol. Its IUPAC name is (2R)-N-(2-chlorophenyl)-2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]propanamide.
| Compound Name | (2R)-N-(2-chlorophenyl)-2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 30725312 |
| Molecular Formula | C18H21Cl2N3OS |
| Molecular Weight | 398.36 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | (2R)-N-(2-chlorophenyl)-2-[4-[(5-chlorothiophen-2-yl)methyl]piperazin-1-yl]propanamide |
| SMILES | C[C@H](C(=O)Nc1ccccc1Cl)N1CCN(Cc2ccc(Cl)s2)CC1 |
| InChI | InChI=1S/C18H21Cl2N3OS/c1-13(18(24)21-16-5-3-2-4-15(16)19)23-10-8-22(9-11-23)12-14-6-7-17(20)25-14/h2-7,13H,8-12H2,1H3,(H,21,24)/t13-/m1/s1 |
| InChIKey | BMMINVQYUHFCSL-CYBMUJFWSA-N |
| XLogP | 4.20 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |