C20H23Cl2N3O — CID 2690189
(2R)-2-(4-benzylpiperazin-1-yl)-N-(2,5-dichlorophenyl)propanamide (PubChem CID 2690189) has the molecular formula C20H23Cl2N3O and a molecular weight of 392.33 g/mol. Its IUPAC name is (2R)-2-(4-benzylpiperazin-1-yl)-N-(2,5-dichlorophenyl)propanamide.
| Compound Name | (2R)-2-(4-benzylpiperazin-1-yl)-N-(2,5-dichlorophenyl)propanamide |
|---|---|
| PubChem CID | 2690189 |
| Molecular Formula | C20H23Cl2N3O |
| Molecular Weight | 392.33 g/mol |
| Exact Mass | 391.12 |
| IUPAC Name | (2R)-2-(4-benzylpiperazin-1-yl)-N-(2,5-dichlorophenyl)propanamide |
| SMILES | C[C@H](C(=O)Nc1cc(Cl)ccc1Cl)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C20H23Cl2N3O/c1-15(20(26)23-19-13-17(21)7-8-18(19)22)25-11-9-24(10-12-25)14-16-5-3-2-4-6-16/h2-8,13,15H,9-12,14H2,1H3,(H,23,26)/t15-/m1/s1 |
| InChIKey | AWLFISADWAJMMO-OAHLLOKOSA-N |
| XLogP | 4.14 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |