C20H25ClN4O — CID 97070928
(2R)-N-(5-chloro-2-methylphenyl)-2-[4-(pyridin-4-ylmethyl)piperazin-1-yl]propanamide (PubChem CID 97070928) has the molecular formula C20H25ClN4O and a molecular weight of 372.90 g/mol. Its IUPAC name is (2R)-N-(5-chloro-2-methylphenyl)-2-[4-(pyridin-4-ylmethyl)piperazin-1-yl]propanamide.
| Compound Name | (2R)-N-(5-chloro-2-methylphenyl)-2-[4-(pyridin-4-ylmethyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 97070928 |
| Molecular Formula | C20H25ClN4O |
| Molecular Weight | 372.90 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | (2R)-N-(5-chloro-2-methylphenyl)-2-[4-(pyridin-4-ylmethyl)piperazin-1-yl]propanamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)[C@@H](C)N1CCN(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C20H25ClN4O/c1-15-3-4-18(21)13-19(15)23-20(26)16(2)25-11-9-24(10-12-25)14-17-5-7-22-8-6-17/h3-8,13,16H,9-12,14H2,1-2H3,(H,23,26)/t16-/m1/s1 |
| InChIKey | YKRLPRHEMYLQHV-MRXNPFEDSA-N |
| XLogP | 3.19 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.90 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |