C15H20Cl2N2O — CID 2690347
(2S)-N-(2,5-dichlorophenyl)-2-(4-methylpiperidin-1-yl)propanamide (PubChem CID 2690347) has the molecular formula C15H20Cl2N2O and a molecular weight of 315.24 g/mol. Its IUPAC name is (2S)-N-(2,5-dichlorophenyl)-2-(4-methylpiperidin-1-yl)propanamide.
| Compound Name | (2S)-N-(2,5-dichlorophenyl)-2-(4-methylpiperidin-1-yl)propanamide |
|---|---|
| PubChem CID | 2690347 |
| Molecular Formula | C15H20Cl2N2O |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | (2S)-N-(2,5-dichlorophenyl)-2-(4-methylpiperidin-1-yl)propanamide |
| SMILES | CC1CCN([C@@H](C)C(=O)Nc2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C15H20Cl2N2O/c1-10-5-7-19(8-6-10)11(2)15(20)18-14-9-12(16)3-4-13(14)17/h3-4,9-11H,5-8H2,1-2H3,(H,18,20)/t11-/m0/s1 |
| InChIKey | KNYJRCCYPMXABX-NSHDSACASA-N |
| XLogP | 4.05 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |