C20H22Cl2FN3O — CID 9258269
(2R)-N-(2-chloro-4-fluorophenyl)-2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]propanamide (PubChem CID 9258269) has the molecular formula C20H22Cl2FN3O and a molecular weight of 410.32 g/mol. Its IUPAC name is (2R)-N-(2-chloro-4-fluorophenyl)-2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]propanamide.
| Compound Name | (2R)-N-(2-chloro-4-fluorophenyl)-2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 9258269 |
| Molecular Formula | C20H22Cl2FN3O |
| Molecular Weight | 410.32 g/mol |
| Exact Mass | 409.11 |
| IUPAC Name | (2R)-N-(2-chloro-4-fluorophenyl)-2-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]propanamide |
| SMILES | C[C@H](C(=O)Nc1ccc(F)cc1Cl)N1CCN(Cc2cccc(Cl)c2)CC1 |
| InChI | InChI=1S/C20H22Cl2FN3O/c1-14(20(27)24-19-6-5-17(23)12-18(19)22)26-9-7-25(8-10-26)13-15-3-2-4-16(21)11-15/h2-6,11-12,14H,7-10,13H2,1H3,(H,24,27)/t14-/m1/s1 |
| InChIKey | TWMJWYZMCVVOEH-CQSZACIVSA-N |
| XLogP | 4.28 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.32 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |