C19H20ClF2N3O — CID 51167962
N-(2-chloro-4-fluorophenyl)-2-[4-(4-fluorophenyl)piperazin-1-yl]propanamide (PubChem CID 51167962) has the molecular formula C19H20ClF2N3O and a molecular weight of 379.84 g/mol. Its IUPAC name is N-(2-chloro-4-fluorophenyl)-2-[4-(4-fluorophenyl)piperazin-1-yl]propanamide.
| Compound Name | N-(2-chloro-4-fluorophenyl)-2-[4-(4-fluorophenyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 51167962 |
| Molecular Formula | C19H20ClF2N3O |
| Molecular Weight | 379.84 g/mol |
| Exact Mass | 379.13 |
| IUPAC Name | N-(2-chloro-4-fluorophenyl)-2-[4-(4-fluorophenyl)piperazin-1-yl]propanamide |
| SMILES | CC(C(=O)Nc1ccc(F)cc1Cl)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H20ClF2N3O/c1-13(19(26)23-18-7-4-15(22)12-17(18)20)24-8-10-25(11-9-24)16-5-2-14(21)3-6-16/h2-7,12-13H,8-11H2,1H3,(H,23,26) |
| InChIKey | UANZBLVLDYESIW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.84 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |