C19H20Cl3N3O2 — CID 41038243
(2R)-2-[4-(4-hydroxyphenyl)piperazin-1-yl]-N-(2,4,5-trichlorophenyl)propanamide (PubChem CID 41038243) has the molecular formula C19H20Cl3N3O2 and a molecular weight of 428.75 g/mol. Its IUPAC name is (2R)-2-[4-(4-hydroxyphenyl)piperazin-1-yl]-N-(2,4,5-trichlorophenyl)propanamide.
| Compound Name | (2R)-2-[4-(4-hydroxyphenyl)piperazin-1-yl]-N-(2,4,5-trichlorophenyl)propanamide |
|---|---|
| PubChem CID | 41038243 |
| Molecular Formula | C19H20Cl3N3O2 |
| Molecular Weight | 428.75 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | (2R)-2-[4-(4-hydroxyphenyl)piperazin-1-yl]-N-(2,4,5-trichlorophenyl)propanamide |
| SMILES | C[C@H](C(=O)Nc1cc(Cl)c(Cl)cc1Cl)N1CCN(c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C19H20Cl3N3O2/c1-12(19(27)23-18-11-16(21)15(20)10-17(18)22)24-6-8-25(9-7-24)13-2-4-14(26)5-3-13/h2-5,10-12,26H,6-9H2,1H3,(H,23,27)/t12-/m1/s1 |
| InChIKey | HVCBFCIPABFZTF-GFCCVEGCSA-N |
| XLogP | 4.50 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.75 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|