C23H31ClN4O4S — CID 42996447
N-[2-chloro-5-(diethylsulfamoyl)phenyl]-2-[4-(4-hydroxyphenyl)piperazin-1-yl]propanamide (PubChem CID 42996447) has the molecular formula C23H31ClN4O4S and a molecular weight of 495.05 g/mol. Its IUPAC name is N-[2-chloro-5-(diethylsulfamoyl)phenyl]-2-[4-(4-hydroxyphenyl)piperazin-1-yl]propanamide.
| Compound Name | N-[2-chloro-5-(diethylsulfamoyl)phenyl]-2-[4-(4-hydroxyphenyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 42996447 |
| Molecular Formula | C23H31ClN4O4S |
| Molecular Weight | 495.05 g/mol |
| Exact Mass | 494.18 |
| IUPAC Name | N-[2-chloro-5-(diethylsulfamoyl)phenyl]-2-[4-(4-hydroxyphenyl)piperazin-1-yl]propanamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Cl)c(NC(=O)C(C)N2CCN(c3ccc(O)cc3)CC2)c1 |
| InChI | InChI=1S/C23H31ClN4O4S/c1-4-28(5-2)33(31,32)20-10-11-21(24)22(16-20)25-23(30)17(3)26-12-14-27(15-13-26)18-6-8-19(29)9-7-18/h6-11,16-17,29H,4-5,12-15H2,1-3H3,(H,25,30) |
| InChIKey | MFUMIXGVPHOQRE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.05 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |